C25H28N2OS — CID 4286477
2-(1-adamantyl)-N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]acetamide (PubChem CID 4286477) has the molecular formula C25H28N2OS and a molecular weight of 404.58 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 4286477 |
| Molecular Formula | C25H28N2OS |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 2-(1-adamantyl)-N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]acetamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)CC34CC5CC(CC(C5)C3)C4)c2C#N)c1 |
| InChI | InChI=1S/C25H28N2OS/c1-15-3-4-16(2)20(5-15)22-14-29-24(21(22)13-26)27-23(28)12-25-9-17-6-18(10-25)8-19(7-17)11-25/h3-5,14,17-19H,6-12H2,1-2H3,(H,27,28) |
| InChIKey | UYYPPEKOMLCYNA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |