C23H15N3O5S — CID 2225550
N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]-6-nitro-2-oxochromene-3-carboxamide (PubChem CID 2225550) has the molecular formula C23H15N3O5S and a molecular weight of 445.46 g/mol. Its IUPAC name is N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]-6-nitro-2-oxochromene-3-carboxamide.
| Compound Name | N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]-6-nitro-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 2225550 |
| Molecular Formula | C23H15N3O5S |
| Molecular Weight | 445.46 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | N-[3-cyano-4-(2,5-dimethylphenyl)thiophen-2-yl]-6-nitro-2-oxochromene-3-carboxamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)c3cc4cc([N+](=O)[O-])ccc4oc3=O)c2C#N)c1 |
| InChI | InChI=1S/C23H15N3O5S/c1-12-3-4-13(2)16(7-12)19-11-32-22(18(19)10-24)25-21(27)17-9-14-8-15(26(29)30)5-6-20(14)31-23(17)28/h3-9,11H,1-2H3,(H,25,27) |
| InChIKey | KMLNAZMBLZTHOM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 126.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.46 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|