C20H26N2O3 — CID 108755461
ethyl 2-[[2-(1-adamantyl)acetyl]amino]pyridine-4-carboxylate (PubChem CID 108755461) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl 2-[[2-(1-adamantyl)acetyl]amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[[2-(1-adamantyl)acetyl]amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108755461 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl 2-[[2-(1-adamantyl)acetyl]amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(NC(=O)CC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C20H26N2O3/c1-2-25-19(24)16-3-4-21-17(8-16)22-18(23)12-20-9-13-5-14(10-20)7-15(6-13)11-20/h3-4,8,13-15H,2,5-7,9-12H2,1H3,(H,21,22,23) |
| InChIKey | ZUURRAHKWGQIRA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |