C16H17BrClN3O2 — CID 108882569
1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-methyl-2-pyridinyl)urea (PubChem CID 108882569) has the molecular formula C16H17BrClN3O2 and a molecular weight of 398.69 g/mol. Its IUPAC name is 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-methyl-2-pyridinyl)urea.
| Compound Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-methyl-2-pyridinyl)urea |
|---|---|
| PubChem CID | 108882569 |
| Molecular Formula | C16H17BrClN3O2 |
| Molecular Weight | 398.69 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | 1-[3-(4-bromo-2-chlorophenoxy)propyl]-3-(3-methyl-2-pyridinyl)urea |
| SMILES | Cc1cccnc1NC(=O)NCCCOc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C16H17BrClN3O2/c1-11-4-2-7-19-15(11)21-16(22)20-8-3-9-23-14-6-5-12(17)10-13(14)18/h2,4-7,10H,3,8-9H2,1H3,(H2,19,20,21,22) |
| InChIKey | KSVMHEQPBGSREF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.69 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|