C12H17N3O5 — CID 140714223
deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate (PubChem CID 140714223) has the molecular formula C12H17N3O5 and a molecular weight of 284.29 g/mol. Its IUPAC name is deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate.
| Compound Name | deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate |
|---|---|
| PubChem CID | 140714223 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate |
| SMILES | [2H]OC(=O)NCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9(13-8-14-12(19)20)4-2-1-3-7-15-10(17)5-6-11(15)18/h5-6,14H,1-4,7-8H2,(H,13,16)(H,19,20)/i/hD |
| InChIKey | AGMXSCYCEIGAMF-DYCDLGHISA-N |
| XLogP | -0.19 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|