About deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate
deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate (PubChem CID 140714223) has the molecular formula C12H17N3O5
and a molecular weight of 284.29 g/mol. Its IUPAC name is deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate.
Molecular Properties
| Compound Name | deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate |
| PubChem CID | 140714223 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate |
| SMILES | [2H]OC(=O)NCNC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C12H17N3O5/c16-9(13-8-14-12(19)20)4-2-1-3-7-15-10(17)5-6-11(15)18/h5-6,14H,1-4,7-8H2,(H,13,16)(H,19,20)/i/hD |
| InChIKey | AGMXSCYCEIGAMF-DYCDLGHISA-N |
| XLogP | -0.19 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate?
The IUPAC name of deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate (CID 140714223) is deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate.
What is the SMILES notation for deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate?
The canonical SMILES for deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate is [2H]OC(=O)NCNC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate?
The InChIKey is AGMXSCYCEIGAMF-DYCDLGHISA-N. The full InChI is InChI=1S/C12H17N3O5/c16-9(13-8-14-12(19)20)4-2-1-3-7-15-10(17)5-6-11(15)18/h5-6,14H,1-4,7-8H2,(H,13,16)(H,19,20)/i/hD.
What are the key properties of deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate?
deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate has a molecular weight of 284.29 g/mol, XLogP of -0.19, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio N-[[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]methyl]carbamate is sourced from PubChem (CID 140714223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).