C39H58N5O5S+ — CID 140682305
tert-butyl-[3-(2,2-dimethylpropyl)-7-[4-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoyl]piperazin-1-yl]-6-hydroxy-1H-indol-2-yl]sulfanium (PubChem CID 140682305) has the molecular formula C39H58N5O5S+ and a molecular weight of 708.99 g/mol. Its IUPAC name is tert-butyl-[3-(2,2-dimethylpropyl)-7-[4-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoyl]piperazin-1-yl]-6-hydroxy-1H-indol-2-yl]sulfanium.
| Compound Name | tert-butyl-[3-(2,2-dimethylpropyl)-7-[4-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoyl]piperazin-1-yl]-6-hydroxy-1H-indol-2-yl]sulfanium |
|---|---|
| PubChem CID | 140682305 |
| Molecular Formula | C39H58N5O5S+ |
| Molecular Weight | 708.99 g/mol |
| Exact Mass | 708.42 |
| IUPAC Name | tert-butyl-[3-(2,2-dimethylpropyl)-7-[4-[6-[[4-[(2,5-dioxopyrrol-1-yl)methyl]cyclohexanecarbonyl]amino]hexanoyl]piperazin-1-yl]-6-hydroxy-1H-indol-2-yl]sulfanium |
| SMILES | CC(C)(C)Cc1c([SH+]C(C)(C)C)[nH]c2c(N3CCN(C(=O)CCCCCNC(=O)C4CCC(CN5C(=O)C=CC5=O)CC4)CC3)c(O)ccc12 |
| InChI | InChI=1S/C39H57N5O5S/c1-38(2,3)24-29-28-15-16-30(45)35(34(28)41-37(29)50-39(4,5)6)43-22-20-42(21-23-43)31(46)10-8-7-9-19-40-36(49)27-13-11-26(12-14-27)25-44-32(47)17-18-33(44)48/h15-18,26-27,41,45H,7-14,19-25H2,1-6H3,(H,40,49)/p+1 |
| InChIKey | DCDGPQVBMXNFNW-UHFFFAOYSA-O |
| XLogP | 5.49 |
| TPSA | 126.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.99 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|