C30H51N3O4S — CID 159843128
tert-butyl-[3-(2,2-dimethylpropyl)-6-hydroxy-7-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-yl]methyl]-1H-indol-2-yl]sulfanium hydroxide (PubChem CID 159843128) has the molecular formula C30H51N3O4S and a molecular weight of 549.82 g/mol. Its IUPAC name is tert-butyl-[3-(2,2-dimethylpropyl)-6-hydroxy-7-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-yl]methyl]-1H-indol-2-yl]sulfanium hydroxide.
| Compound Name | tert-butyl-[3-(2,2-dimethylpropyl)-6-hydroxy-7-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-yl]methyl]-1H-indol-2-yl]sulfanium hydroxide |
|---|---|
| PubChem CID | 159843128 |
| Molecular Formula | C30H51N3O4S |
| Molecular Weight | 549.82 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | tert-butyl-[3-(2,2-dimethylpropyl)-6-hydroxy-7-[[4-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]piperidin-1-yl]methyl]-1H-indol-2-yl]sulfanium hydroxide |
| SMILES | CC(C)(C)Cc1c([SH+]C(C)(C)C)[nH]c2c(CN3CCC(CCNC(=O)OC(C)(C)C)CC3)c(O)ccc12.[OH-] |
| InChI | InChI=1S/C30H49N3O3S.H2O/c1-28(2,3)18-22-21-10-11-24(34)23(25(21)32-26(22)37-30(7,8)9)19-33-16-13-20(14-17-33)12-15-31-27(35)36-29(4,5)6;/h10-11,20,32,34H,12-19H2,1-9H3,(H,31,35);1H2 |
| InChIKey | MSXURCJMVSTHPH-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.82 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|