C35H60N6O9 — CID 158037727
tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-7-diazo-6-oxoheptyl]carbamate;(2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 158037727) has the molecular formula C35H60N6O9 and a molecular weight of 708.90 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-7-diazo-6-oxoheptyl]carbamate;(2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-7-diazo-6-oxoheptyl]carbamate;(2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 158037727 |
| Molecular Formula | C35H60N6O9 |
| Molecular Weight | 708.90 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-7-diazo-6-oxoheptyl]carbamate;(2S)-2-(cyclopentanecarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)C1CCCC1)C(=O)C=[N+]=[N-].CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)C1CCCC1)C(=O)O |
| InChI | InChI=1S/C18H30N4O4.C17H30N2O5/c1-18(2,3)26-17(25)20-11-7-6-10-14(15(23)12-21-19)22-16(24)13-8-4-5-9-13;1-17(2,3)24-16(23)18-11-7-6-10-13(15(21)22)19-14(20)12-8-4-5-9-12/h12-14H,4-11H2,1-3H3,(H,20,25)(H,22,24);12-13H,4-11H2,1-3H3,(H,18,23)(H,19,20)(H,21,22)/t14-;13-/m00/s1 |
| InChIKey | FHYSPMXVFNPQBP-ALKXEWLGSA-N |
| XLogP | 4.67 |
| TPSA | 225.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.90 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|