C20H33F3N2O5 — CID 134356535
tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-6-oxo-7-(2,2,2-trifluoroethoxy)heptyl]carbamate (PubChem CID 134356535) has the molecular formula C20H33F3N2O5 and a molecular weight of 438.49 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-6-oxo-7-(2,2,2-trifluoroethoxy)heptyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-6-oxo-7-(2,2,2-trifluoroethoxy)heptyl]carbamate |
|---|---|
| PubChem CID | 134356535 |
| Molecular Formula | C20H33F3N2O5 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | tert-butyl N-[(5S)-5-(cyclopentanecarbonylamino)-6-oxo-7-(2,2,2-trifluoroethoxy)heptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)C1CCCC1)C(=O)COCC(F)(F)F |
| InChI | InChI=1S/C20H33F3N2O5/c1-19(2,3)30-18(28)24-11-7-6-10-15(16(26)12-29-13-20(21,22)23)25-17(27)14-8-4-5-9-14/h14-15H,4-13H2,1-3H3,(H,24,28)(H,25,27)/t15-/m0/s1 |
| InChIKey | SQKITJPOVZUMFQ-HNNXBMFYSA-N |
| XLogP | 3.50 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|