C30H41N3O6 — CID 58473684
4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[7-[4-(4-methylphenoxy)butylamino]-4,7-dioxoheptyl]cyclohexane-1-carboxamide (PubChem CID 58473684) has the molecular formula C30H41N3O6 and a molecular weight of 539.67 g/mol. Its IUPAC name is 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[7-[4-(4-methylphenoxy)butylamino]-4,7-dioxoheptyl]cyclohexane-1-carboxamide.
| Compound Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[7-[4-(4-methylphenoxy)butylamino]-4,7-dioxoheptyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58473684 |
| Molecular Formula | C30H41N3O6 |
| Molecular Weight | 539.67 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | 4-[(2,5-dioxopyrrol-1-yl)methyl]-N-[7-[4-(4-methylphenoxy)butylamino]-4,7-dioxoheptyl]cyclohexane-1-carboxamide |
| SMILES | Cc1ccc(OCCCCNC(=O)CCC(=O)CCCNC(=O)C2CCC(CN3C(=O)C=CC3=O)CC2)cc1 |
| InChI | InChI=1S/C30H41N3O6/c1-22-6-13-26(14-7-22)39-20-3-2-18-31-27(35)15-12-25(34)5-4-19-32-30(38)24-10-8-23(9-11-24)21-33-28(36)16-17-29(33)37/h6-7,13-14,16-17,23-24H,2-5,8-12,15,18-21H2,1H3,(H,31,35)(H,32,38) |
| InChIKey | XOFSUZDETJAIGW-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.67 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|