C10H16FN3O4 — CID 169190037
2-amino-6-[(3-fluoro-2-oxoazetidine-1-carbonyl)amino]hexanoic acid (PubChem CID 169190037) has the molecular formula C10H16FN3O4 and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-amino-6-[(3-fluoro-2-oxoazetidine-1-carbonyl)amino]hexanoic acid.
| Compound Name | 2-amino-6-[(3-fluoro-2-oxoazetidine-1-carbonyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 169190037 |
| Molecular Formula | C10H16FN3O4 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | 2-amino-6-[(3-fluoro-2-oxoazetidine-1-carbonyl)amino]hexanoic acid |
| SMILES | NC(CCCCNC(=O)N1CC(F)C1=O)C(=O)O |
| InChI | InChI=1S/C10H16FN3O4/c11-6-5-14(8(6)15)10(18)13-4-2-1-3-7(12)9(16)17/h6-7H,1-5,12H2,(H,13,18)(H,16,17) |
| InChIKey | ILTHYINKRVJTCZ-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|