C13H19N3O3 — CID 14628128
(2S)-2-amino-6-[(2-pyridin-3-ylacetyl)amino]hexanoic acid (PubChem CID 14628128) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is (2S)-2-amino-6-[(2-pyridin-3-ylacetyl)amino]hexanoic acid.
| Compound Name | (2S)-2-amino-6-[(2-pyridin-3-ylacetyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 14628128 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | (2S)-2-amino-6-[(2-pyridin-3-ylacetyl)amino]hexanoic acid |
| SMILES | N[C@@H](CCCCNC(=O)Cc1cccnc1)C(=O)O |
| InChI | InChI=1S/C13H19N3O3/c14-11(13(18)19)5-1-2-7-16-12(17)8-10-4-3-6-15-9-10/h3-4,6,9,11H,1-2,5,7-8,14H2,(H,16,17)(H,18,19)/t11-/m0/s1 |
| InChIKey | FRHQNBMVJJTKKH-NSHDSACASA-N |
| XLogP | 0.32 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|