C12H19BN2O4 — CID 175230962
2-amino-7-borono-7-pyridin-3-ylheptanoic acid (PubChem CID 175230962) has the molecular formula C12H19BN2O4 and a molecular weight of 266.11 g/mol. Its IUPAC name is 2-amino-7-borono-7-pyridin-3-ylheptanoic acid.
| Compound Name | 2-amino-7-borono-7-pyridin-3-ylheptanoic acid |
|---|---|
| PubChem CID | 175230962 |
| Molecular Formula | C12H19BN2O4 |
| Molecular Weight | 266.11 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-amino-7-borono-7-pyridin-3-ylheptanoic acid |
| SMILES | NC(CCCCC(B(O)O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C12H19BN2O4/c14-11(12(16)17)6-2-1-5-10(13(18)19)9-4-3-7-15-8-9/h3-4,7-8,10-11,18-19H,1-2,5-6,14H2,(H,16,17) |
| InChIKey | MROJGYNDOQXJPH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.11 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|