C14H30N2O4S — CID 103913962
tert-butyl N-[3-methyl-1-(1-methylsulfonylpropan-2-ylamino)butan-2-yl]carbamate (PubChem CID 103913962) has the molecular formula C14H30N2O4S and a molecular weight of 322.47 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-(1-methylsulfonylpropan-2-ylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-(1-methylsulfonylpropan-2-ylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 103913962 |
| Molecular Formula | C14H30N2O4S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | tert-butyl N-[3-methyl-1-(1-methylsulfonylpropan-2-ylamino)butan-2-yl]carbamate |
| SMILES | CC(CS(C)(=O)=O)NCC(NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C14H30N2O4S/c1-10(2)12(16-13(17)20-14(4,5)6)8-15-11(3)9-21(7,18)19/h10-12,15H,8-9H2,1-7H3,(H,16,17) |
| InChIKey | RGSDGWUKMUKLSK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |