C9H18BrNO3 — CID 175914357
tert-butyl N-[(2S)-1-bromo-1-methoxypropan-2-yl]carbamate (PubChem CID 175914357) has the molecular formula C9H18BrNO3 and a molecular weight of 268.15 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-bromo-1-methoxypropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-bromo-1-methoxypropan-2-yl]carbamate |
|---|---|
| PubChem CID | 175914357 |
| Molecular Formula | C9H18BrNO3 |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | tert-butyl N-[(2S)-1-bromo-1-methoxypropan-2-yl]carbamate |
| SMILES | COC(Br)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C9H18BrNO3/c1-6(7(10)13-5)11-8(12)14-9(2,3)4/h6-7H,1-5H3,(H,11,12)/t6-,7?/m0/s1 |
| InChIKey | WNGTWQNRBCGRMO-PKPIPKONSA-N |
| XLogP | 2.27 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|