C12H21N3O2 — CID 102730571
tert-butyl N-[1-cyano-1-(cyclopropylamino)propan-2-yl]carbamate (PubChem CID 102730571) has the molecular formula C12H21N3O2 and a molecular weight of 239.32 g/mol. Its IUPAC name is tert-butyl N-[1-cyano-1-(cyclopropylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-cyano-1-(cyclopropylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 102730571 |
| Molecular Formula | C12H21N3O2 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.16 |
| IUPAC Name | tert-butyl N-[1-cyano-1-(cyclopropylamino)propan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(C#N)NC1CC1 |
| InChI | InChI=1S/C12H21N3O2/c1-8(10(7-13)15-9-5-6-9)14-11(16)17-12(2,3)4/h8-10,15H,5-6H2,1-4H3,(H,14,16) |
| InChIKey | NDGCRTNLFCGMCA-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |