C10H19N3O2 — CID 102730560
tert-butyl N-[1-cyano-1-(methylamino)propan-2-yl]carbamate (PubChem CID 102730560) has the molecular formula C10H19N3O2 and a molecular weight of 213.28 g/mol. Its IUPAC name is tert-butyl N-[1-cyano-1-(methylamino)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-cyano-1-(methylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 102730560 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | tert-butyl N-[1-cyano-1-(methylamino)propan-2-yl]carbamate |
| SMILES | CNC(C#N)C(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O2/c1-7(8(6-11)12-5)13-9(14)15-10(2,3)4/h7-8,12H,1-5H3,(H,13,14) |
| InChIKey | KUWYCMGVBSASEE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |