C13H23N3O2 — CID 121209947
tert-butyl 3-[(1-cyano-2-methylpropyl)amino]azetidine-1-carboxylate (PubChem CID 121209947) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is tert-butyl 3-[(1-cyano-2-methylpropyl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1-cyano-2-methylpropyl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 121209947 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | tert-butyl 3-[(1-cyano-2-methylpropyl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)C(C#N)NC1CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H23N3O2/c1-9(2)11(6-14)15-10-7-16(8-10)12(17)18-13(3,4)5/h9-11,15H,7-8H2,1-5H3 |
| InChIKey | ZKVTYKDBHWCXJI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |