C26H47NO6 — CID 88863372
3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-octadec-9-enoyl]oxypropanoic acid (PubChem CID 88863372) has the molecular formula C26H47NO6 and a molecular weight of 469.66 g/mol. Its IUPAC name is 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-octadec-9-enoyl]oxypropanoic acid.
| Compound Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-octadec-9-enoyl]oxypropanoic acid |
|---|---|
| PubChem CID | 88863372 |
| Molecular Formula | C26H47NO6 |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.34 |
| IUPAC Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-[(E)-octadec-9-enoyl]oxypropanoic acid |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC(CNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C26H47NO6/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(28)32-22(24(29)30)21-27-25(31)33-26(2,3)4/h12-13,22H,5-11,14-21H2,1-4H3,(H,27,31)(H,29,30)/b13-12+ |
| InChIKey | JBONACAQSIMVSP-OUKQBFOZSA-N |
| XLogP | 6.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|