3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid

C22H38O4S — CID 123327676

IUPAC3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid
SMILESCCCCCC=CCC=CCCCCCCCC(=O)OC(CSC)C(=O)O
InChIInChI=1S/C22H38O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)26-20(19-27-2)22(24)25/h7-8,10-11,20H,3-6,9,12-19H2,1-2H3,(H,24,25)
InChIKeyOZWRNXFUPCTGCV-UHFFFAOYSA-N
MW398.61 g/mol
LogP6.16
Rot. Bonds18

About 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid

3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid (PubChem CID 123327676) has the molecular formula C22H38O4S and a molecular weight of 398.61 g/mol. Its IUPAC name is 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid.

Molecular Properties

Compound Name3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid
PubChem CID123327676
Molecular FormulaC22H38O4S
Molecular Weight398.61 g/mol
Exact Mass398.25
IUPAC Name3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid
SMILESCCCCCC=CCC=CCCCCCCCC(=O)OC(CSC)C(=O)O
InChIInChI=1S/C22H38O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)26-20(19-27-2)22(24)25/h7-8,10-11,20H,3-6,9,12-19H2,1-2H3,(H,24,25)
InChIKeyOZWRNXFUPCTGCV-UHFFFAOYSA-N
XLogP6.16
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds18
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500398.61
LogP ≤ 56.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid?
The IUPAC name of 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid (CID 123327676) is 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid.
What is the SMILES notation for 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid?
The canonical SMILES for 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid is CCCCCC=CCC=CCCCCCCCC(=O)OC(CSC)C(=O)O.
What is the InChIKey of 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid?
The InChIKey is OZWRNXFUPCTGCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O4S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)26-20(19-27-2)22(24)25/h7-8,10-11,20H,3-6,9,12-19H2,1-2H3,(H,24,25).
What are the key properties of 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid?
3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid has a molecular weight of 398.61 g/mol, XLogP of 6.16, 18 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanyl-2-octadeca-9,12-dienoyloxypropanoic acid is sourced from PubChem (CID 123327676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).