C18H21F5N2O5S — CID 171927267
2-[[2,2-difluoro-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]sulfonylacetyl]amino]ethyl 2,2-dimethylbutanoate (PubChem CID 171927267) has the molecular formula C18H21F5N2O5S and a molecular weight of 472.43 g/mol. Its IUPAC name is 2-[[2,2-difluoro-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]sulfonylacetyl]amino]ethyl 2,2-dimethylbutanoate.
| Compound Name | 2-[[2,2-difluoro-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]sulfonylacetyl]amino]ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 171927267 |
| Molecular Formula | C18H21F5N2O5S |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | 2-[[2,2-difluoro-2-[(2,2,2-trifluoro-1-phenylethylidene)amino]sulfonylacetyl]amino]ethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)C(F)(F)S(=O)(=O)N=C(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H21F5N2O5S/c1-4-16(2,3)15(27)30-11-10-24-14(26)18(22,23)31(28,29)25-13(17(19,20)21)12-8-6-5-7-9-12/h5-9H,4,10-11H2,1-3H3,(H,24,26) |
| InChIKey | IYHHAZPQWLHVKO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|