About [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate
[2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate (PubChem CID 170532217) has the molecular formula C16H18F2N2O5S
and a molecular weight of 388.39 g/mol. Its IUPAC name is [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate.
Molecular Properties
| Compound Name | [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate |
| PubChem CID | 170532217 |
| Molecular Formula | C16H18F2N2O5S |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate |
| SMILES | [C-]#[N+]C(=NOS(=O)(=O)C(F)(F)COC(=O)C(C)(C)CC)c1ccccc1 |
| InChI | InChI=1S/C16H18F2N2O5S/c1-5-15(2,3)14(21)24-11-16(17,18)26(22,23)25-20-13(19-4)12-9-7-6-8-10-12/h6-10H,5,11H2,1-3H3 |
| InChIKey | UQYZPYHDVYAVKK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate?
The IUPAC name of [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate (CID 170532217) is [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate.
What is the SMILES notation for [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate?
The canonical SMILES for [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate is [C-]#[N+]C(=NOS(=O)(=O)C(F)(F)COC(=O)C(C)(C)CC)c1ccccc1.
What is the InChIKey of [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate?
The InChIKey is UQYZPYHDVYAVKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2N2O5S/c1-5-15(2,3)14(21)24-11-16(17,18)26(22,23)25-20-13(19-4)12-9-7-6-8-10-12/h6-10H,5,11H2,1-3H3.
What are the key properties of [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate?
[2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate has a molecular weight of 388.39 g/mol, XLogP of 3.19, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-2-[[isocyano(phenyl)methylidene]amino]oxysulfonylethyl] 2,2-dimethylbutanoate is sourced from PubChem (CID 170532217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).