C20H20N2O5S — CID 170532227
[4-[[isocyano(phenyl)methylidene]amino]oxysulfonylphenyl] 2,2-dimethylbutanoate (PubChem CID 170532227) has the molecular formula C20H20N2O5S and a molecular weight of 400.46 g/mol. Its IUPAC name is [4-[[isocyano(phenyl)methylidene]amino]oxysulfonylphenyl] 2,2-dimethylbutanoate.
| Compound Name | [4-[[isocyano(phenyl)methylidene]amino]oxysulfonylphenyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 170532227 |
| Molecular Formula | C20H20N2O5S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | [4-[[isocyano(phenyl)methylidene]amino]oxysulfonylphenyl] 2,2-dimethylbutanoate |
| SMILES | [C-]#[N+]C(=NOS(=O)(=O)c1ccc(OC(=O)C(C)(C)CC)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O5S/c1-5-20(2,3)19(23)26-16-11-13-17(14-12-16)28(24,25)27-22-18(21-4)15-9-7-6-8-10-15/h6-14H,5H2,1-3H3 |
| InChIKey | XUAGRKBOQGRVSS-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|