C17H19F2NO7S — CID 134252183
2-(2-methylprop-2-enoylamino)ethyl 2,2-difluoro-2-(1-oxo-1-phenylpropan-2-yl)oxysulfonylacetate (PubChem CID 134252183) has the molecular formula C17H19F2NO7S and a molecular weight of 419.40 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoylamino)ethyl 2,2-difluoro-2-(1-oxo-1-phenylpropan-2-yl)oxysulfonylacetate.
| Compound Name | 2-(2-methylprop-2-enoylamino)ethyl 2,2-difluoro-2-(1-oxo-1-phenylpropan-2-yl)oxysulfonylacetate |
|---|---|
| PubChem CID | 134252183 |
| Molecular Formula | C17H19F2NO7S |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | 2-(2-methylprop-2-enoylamino)ethyl 2,2-difluoro-2-(1-oxo-1-phenylpropan-2-yl)oxysulfonylacetate |
| SMILES | C=C(C)C(=O)NCCOC(=O)C(F)(F)S(=O)(=O)OC(C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H19F2NO7S/c1-11(2)15(22)20-9-10-26-16(23)17(18,19)28(24,25)27-12(3)14(21)13-7-5-4-6-8-13/h4-8,12H,1,9-10H2,2-3H3,(H,20,22) |
| InChIKey | IUGMHGLZUSFUSM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|