C16H27O6P — CID 87234792
bis[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid (PubChem CID 87234792) has the molecular formula C16H27O6P and a molecular weight of 346.36 g/mol. Its IUPAC name is bis[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid.
| Compound Name | bis[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid |
|---|---|
| PubChem CID | 87234792 |
| Molecular Formula | C16H27O6P |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | bis[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid |
| SMILES | C=C(C)C(=O)OCCCCP(=O)(O)CCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C16H27O6P/c1-13(2)15(17)21-9-5-7-11-23(19,20)12-8-6-10-22-16(18)14(3)4/h1,3,5-12H2,2,4H3,(H,19,20) |
| InChIKey | XAPNFRJJWHRHSK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|