C9H17O4P — CID 139843889
methyl-[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid (PubChem CID 139843889) has the molecular formula C9H17O4P and a molecular weight of 220.20 g/mol. Its IUPAC name is methyl-[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid.
| Compound Name | methyl-[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid |
|---|---|
| PubChem CID | 139843889 |
| Molecular Formula | C9H17O4P |
| Molecular Weight | 220.20 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | methyl-[4-(2-methylprop-2-enoyloxy)butyl]phosphinic acid |
| SMILES | C=C(C)C(=O)OCCCCP(C)(=O)O |
| InChI | InChI=1S/C9H17O4P/c1-8(2)9(10)13-6-4-5-7-14(3,11)12/h1,4-7H2,2-3H3,(H,11,12) |
| InChIKey | HJOLOLQUVKBIIZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|