C24H45O7P — CID 10896068
tributyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphanium acetate (PubChem CID 10896068) has the molecular formula C24H45O7P and a molecular weight of 476.59 g/mol. Its IUPAC name is tributyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphanium acetate.
| Compound Name | tributyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphanium acetate |
|---|---|
| PubChem CID | 10896068 |
| Molecular Formula | C24H45O7P |
| Molecular Weight | 476.59 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | tributyl-[3-[2-hydroxy-3-(2-methylprop-2-enoyloxy)propoxy]-3-oxopropyl]phosphanium acetate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CC[P+](CCCC)(CCCC)CCCC.CC(=O)[O-] |
| InChI | InChI=1S/C22H42O5P.C2H4O2/c1-6-9-13-28(14-10-7-2,15-11-8-3)16-12-21(24)26-17-20(23)18-27-22(25)19(4)5;1-2(3)4/h20,23H,4,6-18H2,1-3,5H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | JUYQBARLUBUYMF-UHFFFAOYSA-M |
| XLogP | 3.57 |
| TPSA | 112.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.59 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|