C24H38O5 — CID 59664002
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 8-(6-propylcyclohexa-2,4-dien-1-yl)octanoate (PubChem CID 59664002) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 8-(6-propylcyclohexa-2,4-dien-1-yl)octanoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 8-(6-propylcyclohexa-2,4-dien-1-yl)octanoate |
|---|---|
| PubChem CID | 59664002 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 8-(6-propylcyclohexa-2,4-dien-1-yl)octanoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)CCCCCCCC1C=CC=CC1CCC |
| InChI | InChI=1S/C24H38O5/c1-4-12-20-14-10-11-15-21(20)13-8-6-5-7-9-16-23(26)28-17-22(25)18-29-24(27)19(2)3/h10-11,14-15,20-22,25H,2,4-9,12-13,16-18H2,1,3H3 |
| InChIKey | JLOKCENBZIPDQB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|