C25H31NO8 — CID 154423035
[2-[[2-(4-aminophenyl)-2-oxoethoxy]methyl]-3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate (PubChem CID 154423035) has the molecular formula C25H31NO8 and a molecular weight of 473.52 g/mol. Its IUPAC name is [2-[[2-(4-aminophenyl)-2-oxoethoxy]methyl]-3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[2-(4-aminophenyl)-2-oxoethoxy]methyl]-3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154423035 |
| Molecular Formula | C25H31NO8 |
| Molecular Weight | 473.52 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | [2-[[2-(4-aminophenyl)-2-oxoethoxy]methyl]-3-(2-methylprop-2-enoyloxy)-2-(2-methylprop-2-enoyloxymethyl)propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COCC(=O)c1ccc(N)cc1)(COC(=O)C(=C)C)COC(=O)C(=C)C |
| InChI | InChI=1S/C25H31NO8/c1-16(2)22(28)32-13-25(14-33-23(29)17(3)4,15-34-24(30)18(5)6)12-31-11-21(27)19-7-9-20(26)10-8-19/h7-10H,1,3,5,11-15,26H2,2,4,6H3 |
| InChIKey | FXEFXUGAAIQXLZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.52 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|