C28H32N2O8 — CID 135297388
[2-nitroso-3-[4-[2-[4-(2-nitroso-3-prop-2-enoyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] but-3-enoate (PubChem CID 135297388) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is [2-nitroso-3-[4-[2-[4-(2-nitroso-3-prop-2-enoyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] but-3-enoate.
| Compound Name | [2-nitroso-3-[4-[2-[4-(2-nitroso-3-prop-2-enoyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] but-3-enoate |
|---|---|
| PubChem CID | 135297388 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | [2-nitroso-3-[4-[2-[4-(2-nitroso-3-prop-2-enoyloxypropoxy)phenyl]propan-2-yl]phenoxy]propyl] but-3-enoate |
| SMILES | C=CCC(=O)OCC(COc1ccc(C(C)(C)c2ccc(OCC(COC(=O)C=C)N=O)cc2)cc1)N=O |
| InChI | InChI=1S/C28H32N2O8/c1-5-7-27(32)38-19-23(30-34)17-36-25-14-10-21(11-15-25)28(3,4)20-8-12-24(13-9-20)35-16-22(29-33)18-37-26(31)6-2/h5-6,8-15,22-23H,1-2,7,16-19H2,3-4H3 |
| InChIKey | HFRIMSWAVPQYDG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|