C22H32O5 — CID 67929040
3-hydroxypropyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene (PubChem CID 67929040) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-hydroxypropyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene.
| Compound Name | 3-hydroxypropyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 67929040 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3-hydroxypropyl prop-2-enoate;2-methylpropyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCC(C)C.C=CC(=O)OCCCO.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H14O2.C8H8.C6H10O3/c1-6(2)5-10-8(9)7(3)4;1-2-8-6-4-3-5-7-8;1-2-6(8)9-5-3-4-7/h6H,3,5H2,1-2,4H3;2-7H,1H2;2,7H,1,3-5H2 |
| InChIKey | ZVOADGBOZWRCNH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|