C17H9F3N2O4S — CID 89275620
[4-[(E)-1,2-dicyano-2-(4-hydroxyphenyl)ethenyl]phenyl] trifluoromethanesulfonate (PubChem CID 89275620) has the molecular formula C17H9F3N2O4S and a molecular weight of 394.33 g/mol. Its IUPAC name is [4-[(E)-1,2-dicyano-2-(4-hydroxyphenyl)ethenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[(E)-1,2-dicyano-2-(4-hydroxyphenyl)ethenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89275620 |
| Molecular Formula | C17H9F3N2O4S |
| Molecular Weight | 394.33 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | [4-[(E)-1,2-dicyano-2-(4-hydroxyphenyl)ethenyl]phenyl] trifluoromethanesulfonate |
| SMILES | N#C/C(=C(/C#N)c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H9F3N2O4S/c18-17(19,20)27(24,25)26-14-7-3-12(4-8-14)16(10-22)15(9-21)11-1-5-13(23)6-2-11/h1-8,23H/b16-15+ |
| InChIKey | FGUIPFOCNAVIGE-FOCLMDBBSA-N |
| XLogP | 3.58 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|