C17H17NO4 — CID 177389903
3-O-ethyl 4-O-prop-2-enyl 2-methylquinoline-3,4-dicarboxylate (PubChem CID 177389903) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is 3-O-ethyl 4-O-prop-2-enyl 2-methylquinoline-3,4-dicarboxylate.
| Compound Name | 3-O-ethyl 4-O-prop-2-enyl 2-methylquinoline-3,4-dicarboxylate |
|---|---|
| PubChem CID | 177389903 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 3-O-ethyl 4-O-prop-2-enyl 2-methylquinoline-3,4-dicarboxylate |
| SMILES | C=CCOC(=O)c1c(C(=O)OCC)c(C)nc2ccccc12 |
| InChI | InChI=1S/C17H17NO4/c1-4-10-22-17(20)15-12-8-6-7-9-13(12)18-11(3)14(15)16(19)21-5-2/h4,6-9H,1,5,10H2,2-3H3 |
| InChIKey | RBMUDBDKHCEXHK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|