C13H13NO4 — CID 18947519
bis(prop-2-enyl) pyridine-2,3-dicarboxylate (PubChem CID 18947519) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is bis(prop-2-enyl) pyridine-2,3-dicarboxylate.
| Compound Name | bis(prop-2-enyl) pyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 18947519 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | bis(prop-2-enyl) pyridine-2,3-dicarboxylate |
| SMILES | C=CCOC(=O)c1cccnc1C(=O)OCC=C |
| InChI | InChI=1S/C13H13NO4/c1-3-8-17-12(15)10-6-5-7-14-11(10)13(16)18-9-4-2/h3-7H,1-2,8-9H2 |
| InChIKey | QGMRZBDLKDLPFI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|