C14H16ClN3O3S — CID 141451059
[(2E)-2-[(2-hydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride (PubChem CID 141451059) has the molecular formula C14H16ClN3O3S and a molecular weight of 341.82 g/mol. Its IUPAC name is [(2E)-2-[(2-hydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride.
| Compound Name | [(2E)-2-[(2-hydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 141451059 |
| Molecular Formula | C14H16ClN3O3S |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | [(2E)-2-[(2-hydroxyphenyl)methylhydrazinylidene]ethyl] 4-methyl-1,3-thiazole-5-carboxylate;hydrochloride |
| SMILES | Cc1ncsc1C(=O)OC/C=N/NCc1ccccc1O.Cl |
| InChI | InChI=1S/C14H15N3O3S.ClH/c1-10-13(21-9-15-10)14(19)20-7-6-16-17-8-11-4-2-3-5-12(11)18;/h2-6,9,17-18H,7-8H2,1H3;1H/b16-6+; |
| InChIKey | FDXZIPHISOOGIQ-FPUQOWELSA-N |
| XLogP | 2.51 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|