C13H16N4OS — CID 13151153
(3,4-diaminophenyl)-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methanone (PubChem CID 13151153) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is (3,4-diaminophenyl)-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methanone.
| Compound Name | (3,4-diaminophenyl)-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methanone |
|---|---|
| PubChem CID | 13151153 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3,4-diaminophenyl)-[2-(dimethylamino)-4-methyl-1,3-thiazol-5-yl]methanone |
| SMILES | Cc1nc(N(C)C)sc1C(=O)c1ccc(N)c(N)c1 |
| InChI | InChI=1S/C13H16N4OS/c1-7-12(19-13(16-7)17(2)3)11(18)8-4-5-9(14)10(15)6-8/h4-6H,14-15H2,1-3H3 |
| InChIKey | OJHDUXJVINXJLD-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|