About 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide
4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide (PubChem CID 62792932) has the molecular formula C12H19N5O2S
and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide.
Molecular Properties
| Compound Name | 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide |
| PubChem CID | 62792932 |
| Molecular Formula | C12H19N5O2S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)N1CCN(C(=O)N(C)C)CC1 |
| InChI | InChI=1S/C12H19N5O2S/c1-8-9(20-11(13)14-8)10(18)16-4-6-17(7-5-16)12(19)15(2)3/h4-7H2,1-3H3,(H2,13,14) |
| InChIKey | FFSIDUOGMMLREI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide?
The IUPAC name of 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide (CID 62792932) is 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide.
What is the SMILES notation for 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide?
The canonical SMILES for 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide is Cc1nc(N)sc1C(=O)N1CCN(C(=O)N(C)C)CC1.
What is the InChIKey of 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide?
The InChIKey is FFSIDUOGMMLREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N5O2S/c1-8-9(20-11(13)14-8)10(18)16-4-6-17(7-5-16)12(19)15(2)3/h4-7H2,1-3H3,(H2,13,14).
What are the key properties of 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide?
4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide has a molecular weight of 297.38 g/mol, XLogP of 0.47, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-4-methyl-1,3-thiazole-5-carbonyl)-N,N-dimethylpiperazine-1-carboxamide is sourced from PubChem (CID 62792932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).