About (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone
(2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone (PubChem CID 62793634) has the molecular formula C13H22N4OS
and a molecular weight of 282.41 g/mol. Its IUPAC name is (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone.
Molecular Properties
| Compound Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone |
| PubChem CID | 62793634 |
| Molecular Formula | C13H22N4OS |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone |
| SMILES | Cc1nc(N)sc1C(=O)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H22N4OS/c1-9-10(19-12(14)15-9)11(18)16-5-7-17(8-6-16)13(2,3)4/h5-8H2,1-4H3,(H2,14,15) |
| InChIKey | MJTAHOJCVDFJKA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone?
The IUPAC name of (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone (CID 62793634) is (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone.
What is the SMILES notation for (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone?
The canonical SMILES for (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone is Cc1nc(N)sc1C(=O)N1CCN(C(C)(C)C)CC1.
What is the InChIKey of (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone?
The InChIKey is MJTAHOJCVDFJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N4OS/c1-9-10(19-12(14)15-9)11(18)16-5-7-17(8-6-16)13(2,3)4/h5-8H2,1-4H3,(H2,14,15).
What are the key properties of (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone?
(2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone has a molecular weight of 282.41 g/mol, XLogP of 1.59, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-4-methyl-1,3-thiazol-5-yl)-(4-tert-butylpiperazin-1-yl)methanone is sourced from PubChem (CID 62793634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).