C11H7F4N3OS — CID 107641671
2-amino-4-methyl-N-(2,3,5,6-tetrafluorophenyl)-1,3-thiazole-5-carboxamide (PubChem CID 107641671) has the molecular formula C11H7F4N3OS and a molecular weight of 305.26 g/mol. Its IUPAC name is 2-amino-4-methyl-N-(2,3,5,6-tetrafluorophenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 2-amino-4-methyl-N-(2,3,5,6-tetrafluorophenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 107641671 |
| Molecular Formula | C11H7F4N3OS |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-amino-4-methyl-N-(2,3,5,6-tetrafluorophenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(N)sc1C(=O)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C11H7F4N3OS/c1-3-9(20-11(16)17-3)10(19)18-8-6(14)4(12)2-5(13)7(8)15/h2H,1H3,(H2,16,17)(H,18,19) |
| InChIKey | AYRCKNYRWQQORC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|