C9H11N3OS — CID 163588493
methyl N,3-dimethylimidazo[2,1-b][1,3]thiazole-2-carboximidate (PubChem CID 163588493) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is methyl N,3-dimethylimidazo[2,1-b][1,3]thiazole-2-carboximidate.
| Compound Name | methyl N,3-dimethylimidazo[2,1-b][1,3]thiazole-2-carboximidate |
|---|---|
| PubChem CID | 163588493 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | methyl N,3-dimethylimidazo[2,1-b][1,3]thiazole-2-carboximidate |
| SMILES | C/N=C(\OC)c1sc2nccn2c1C |
| InChI | InChI=1S/C9H11N3OS/c1-6-7(8(10-2)13-3)14-9-11-4-5-12(6)9/h4-5H,1-3H3/b10-8- |
| InChIKey | GNNFZZPKWJWSLT-NTMALXAHSA-N |
| XLogP | 1.73 |
| TPSA | 38.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|