C18H22N2O5S2 — CID 7544102
ethyl 3,4-dimethyl-2-[3-(4-methylphenyl)sulfonylpropanoylimino]-1,3-thiazole-5-carboxylate (PubChem CID 7544102) has the molecular formula C18H22N2O5S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is ethyl 3,4-dimethyl-2-[3-(4-methylphenyl)sulfonylpropanoylimino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 3,4-dimethyl-2-[3-(4-methylphenyl)sulfonylpropanoylimino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 7544102 |
| Molecular Formula | C18H22N2O5S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | ethyl 3,4-dimethyl-2-[3-(4-methylphenyl)sulfonylpropanoylimino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1s/c(=N/C(=O)CCS(=O)(=O)c2ccc(C)cc2)n(C)c1C |
| InChI | InChI=1S/C18H22N2O5S2/c1-5-25-17(22)16-13(3)20(4)18(26-16)19-15(21)10-11-27(23,24)14-8-6-12(2)7-9-14/h6-9H,5,10-11H2,1-4H3/b19-18+ |
| InChIKey | XPHCONNZOOQBPZ-VHEBQXMUSA-N |
| XLogP | 2.17 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|