C19H14ClN3OS3 — CID 23875932
3-chloro-N-[(3,6-dimethyl-1,3-benzothiazol-2-ylidene)carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 23875932) has the molecular formula C19H14ClN3OS3 and a molecular weight of 432.00 g/mol. Its IUPAC name is 3-chloro-N-[(3,6-dimethyl-1,3-benzothiazol-2-ylidene)carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[(3,6-dimethyl-1,3-benzothiazol-2-ylidene)carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 23875932 |
| Molecular Formula | C19H14ClN3OS3 |
| Molecular Weight | 432.00 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 3-chloro-N-[(3,6-dimethyl-1,3-benzothiazol-2-ylidene)carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc2c(c1)sc(=NC(=S)NC(=O)c1sc3ccccc3c1Cl)n2C |
| InChI | InChI=1S/C19H14ClN3OS3/c1-10-7-8-12-14(9-10)27-19(23(12)2)22-18(25)21-17(24)16-15(20)11-5-3-4-6-13(11)26-16/h3-9H,1-2H3,(H,21,24,25) |
| InChIKey | LVAYZXHCBABYGW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.00 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|