C18H18BrN3O2S — CID 54791812
N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-4-bromobenzamide (PubChem CID 54791812) has the molecular formula C18H18BrN3O2S and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-4-bromobenzamide.
| Compound Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-4-bromobenzamide |
|---|---|
| PubChem CID | 54791812 |
| Molecular Formula | C18H18BrN3O2S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | N-[(3-amino-3-oxopropyl)-benzylcarbamothioyl]-4-bromobenzamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H18BrN3O2S/c19-15-8-6-14(7-9-15)17(24)21-18(25)22(11-10-16(20)23)12-13-4-2-1-3-5-13/h1-9H,10-12H2,(H2,20,23)(H,21,24,25) |
| InChIKey | XJLULWRDVWBQMP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|