C22H21N3O3S — CID 88968404
N-(dibenzylcarbamothioyl)-4-(dihydroxyamino)benzamide (PubChem CID 88968404) has the molecular formula C22H21N3O3S and a molecular weight of 407.50 g/mol. Its IUPAC name is N-(dibenzylcarbamothioyl)-4-(dihydroxyamino)benzamide.
| Compound Name | N-(dibenzylcarbamothioyl)-4-(dihydroxyamino)benzamide |
|---|---|
| PubChem CID | 88968404 |
| Molecular Formula | C22H21N3O3S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-(dibenzylcarbamothioyl)-4-(dihydroxyamino)benzamide |
| SMILES | O=C(NC(=S)N(Cc1ccccc1)Cc1ccccc1)c1ccc(N(O)O)cc1 |
| InChI | InChI=1S/C22H21N3O3S/c26-21(19-11-13-20(14-12-19)25(27)28)23-22(29)24(15-17-7-3-1-4-8-17)16-18-9-5-2-6-10-18/h1-14,27-28H,15-16H2,(H,23,26,29) |
| InChIKey | RAJPNHOWZRERCU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|