C25H32N2O4S — CID 43910832
ethyl 3-[benzyl-[(4-pentoxybenzoyl)carbamothioyl]amino]propanoate (PubChem CID 43910832) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is ethyl 3-[benzyl-[(4-pentoxybenzoyl)carbamothioyl]amino]propanoate.
| Compound Name | ethyl 3-[benzyl-[(4-pentoxybenzoyl)carbamothioyl]amino]propanoate |
|---|---|
| PubChem CID | 43910832 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | ethyl 3-[benzyl-[(4-pentoxybenzoyl)carbamothioyl]amino]propanoate |
| SMILES | CCCCCOc1ccc(C(=O)NC(=S)N(CCC(=O)OCC)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H32N2O4S/c1-3-5-9-18-31-22-14-12-21(13-15-22)24(29)26-25(32)27(17-16-23(28)30-4-2)19-20-10-7-6-8-11-20/h6-8,10-15H,3-5,9,16-19H2,1-2H3,(H,26,29,32) |
| InChIKey | MILHUIPVFTZLEE-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|