C20H28N2O3S — CID 43910805
ethyl 3-[benzyl(cyclohexanecarbonylcarbamothioyl)amino]propanoate (PubChem CID 43910805) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is ethyl 3-[benzyl(cyclohexanecarbonylcarbamothioyl)amino]propanoate.
| Compound Name | ethyl 3-[benzyl(cyclohexanecarbonylcarbamothioyl)amino]propanoate |
|---|---|
| PubChem CID | 43910805 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | ethyl 3-[benzyl(cyclohexanecarbonylcarbamothioyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H28N2O3S/c1-2-25-18(23)13-14-22(15-16-9-5-3-6-10-16)20(26)21-19(24)17-11-7-4-8-12-17/h3,5-6,9-10,17H,2,4,7-8,11-15H2,1H3,(H,21,24,26) |
| InChIKey | KFFYMQNJAQVIJG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|