C22H32N2O3S — CID 43910831
ethyl 3-[benzyl(3-cyclohexylpropanoylcarbamothioyl)amino]propanoate (PubChem CID 43910831) has the molecular formula C22H32N2O3S and a molecular weight of 404.58 g/mol. Its IUPAC name is ethyl 3-[benzyl(3-cyclohexylpropanoylcarbamothioyl)amino]propanoate.
| Compound Name | ethyl 3-[benzyl(3-cyclohexylpropanoylcarbamothioyl)amino]propanoate |
|---|---|
| PubChem CID | 43910831 |
| Molecular Formula | C22H32N2O3S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethyl 3-[benzyl(3-cyclohexylpropanoylcarbamothioyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccccc1)C(=S)NC(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C22H32N2O3S/c1-2-27-21(26)15-16-24(17-19-11-7-4-8-12-19)22(28)23-20(25)14-13-18-9-5-3-6-10-18/h4,7-8,11-12,18H,2-3,5-6,9-10,13-17H2,1H3,(H,23,25,28) |
| InChIKey | RTBRMYSAQVMLAX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|