C18H17F3N2O2 — CID 17397571
N-(3-amino-3-oxopropyl)-N-benzyl-3-(trifluoromethyl)benzamide (PubChem CID 17397571) has the molecular formula C18H17F3N2O2 and a molecular weight of 350.34 g/mol. Its IUPAC name is N-(3-amino-3-oxopropyl)-N-benzyl-3-(trifluoromethyl)benzamide.
| Compound Name | N-(3-amino-3-oxopropyl)-N-benzyl-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 17397571 |
| Molecular Formula | C18H17F3N2O2 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | N-(3-amino-3-oxopropyl)-N-benzyl-3-(trifluoromethyl)benzamide |
| SMILES | NC(=O)CCN(Cc1ccccc1)C(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O2/c19-18(20,21)15-8-4-7-14(11-15)17(25)23(10-9-16(22)24)12-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H2,22,24) |
| InChIKey | RVFFOXIMYIOBIZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |