C23H22F3N3O2 — CID 144888100
2-amino-N-(2-amino-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide;benzene (PubChem CID 144888100) has the molecular formula C23H22F3N3O2 and a molecular weight of 429.44 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide;benzene.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide;benzene |
|---|---|
| PubChem CID | 144888100 |
| Molecular Formula | C23H22F3N3O2 |
| Molecular Weight | 429.44 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-N-[[3-(trifluoromethyl)phenyl]methyl]benzamide;benzene |
| SMILES | NC(=O)CN(Cc1cccc(C(F)(F)F)c1)C(=O)c1ccccc1N.c1ccccc1 |
| InChI | InChI=1S/C17H16F3N3O2.C6H6/c18-17(19,20)12-5-3-4-11(8-12)9-23(10-15(22)24)16(25)13-6-1-2-7-14(13)21;1-2-4-6-5-3-1/h1-8H,9-10,21H2,(H2,22,24);1-6H |
| InChIKey | KWKSMPYXBHHGFF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|