C23H25N3O3 — CID 109171538
N-benzyl-2-(2,4-dimethoxyanilino)-N-ethylpyridine-4-carboxamide (PubChem CID 109171538) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is N-benzyl-2-(2,4-dimethoxyanilino)-N-ethylpyridine-4-carboxamide.
| Compound Name | N-benzyl-2-(2,4-dimethoxyanilino)-N-ethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 109171538 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | N-benzyl-2-(2,4-dimethoxyanilino)-N-ethylpyridine-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccnc(Nc2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-4-26(16-17-8-6-5-7-9-17)23(27)18-12-13-24-22(14-18)25-20-11-10-19(28-2)15-21(20)29-3/h5-15H,4,16H2,1-3H3,(H,24,25) |
| InChIKey | QKVLRDKTXNPUQS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |